C17H17ClN4O3 — CID 126794812
3-chloro-5-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]benzoic acid (PubChem CID 126794812) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is 3-chloro-5-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]benzoic acid.
| Compound Name | 3-chloro-5-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 126794812 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-chloro-5-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(NC(=O)C2CCN(c3cnccn3)CC2)c1 |
| InChI | InChI=1S/C17H17ClN4O3/c18-13-7-12(17(24)25)8-14(9-13)21-16(23)11-1-5-22(6-2-11)15-10-19-3-4-20-15/h3-4,7-11H,1-2,5-6H2,(H,21,23)(H,24,25) |
| InChIKey | BUKJEYSFZPVMAC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |