C24H24FN5O2 — CID 78892568
N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-1-pyrazin-2-ylpiperidine-4-carboxamide (PubChem CID 78892568) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-1-pyrazin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-1-pyrazin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78892568 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-1-pyrazin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Cc1ccccc1)Nc1cc(NC(=O)C2CCN(c3cnccn3)CC2)ccc1F |
| InChI | InChI=1S/C24H24FN5O2/c25-20-7-6-19(15-21(20)29-23(31)14-17-4-2-1-3-5-17)28-24(32)18-8-12-30(13-9-18)22-16-26-10-11-27-22/h1-7,10-11,15-16,18H,8-9,12-14H2,(H,28,32)(H,29,31) |
| InChIKey | UUGXCJPNTANKRZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |