C16H16F2N4O — CID 3222644
N-(2,4-difluorophenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide (PubChem CID 3222644) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3222644 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C16H16F2N4O/c17-12-1-2-14(13(18)9-12)21-16(23)11-3-7-22(8-4-11)15-10-19-5-6-20-15/h1-2,5-6,9-11H,3-4,7-8H2,(H,21,23) |
| InChIKey | TWEORBZOEROZHO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |