C12H11ClN2O3S2 — CID 126816709
N-(2-chloro-1,3-benzothiazol-6-yl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 126816709) has the molecular formula C12H11ClN2O3S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is N-(2-chloro-1,3-benzothiazol-6-yl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-chloro-1,3-benzothiazol-6-yl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 126816709 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | N-(2-chloro-1,3-benzothiazol-6-yl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc(Cl)sc2c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H11ClN2O3S2/c13-12-15-9-2-1-8(5-10(9)19-12)14-11(16)7-3-4-20(17,18)6-7/h1-2,5,7H,3-4,6H2,(H,14,16) |
| InChIKey | ZAWJSTMYRYDDBE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |