C12H13N3O3S — CID 97079601
(3S)-N-(1H-indazol-5-yl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 97079601) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is (3S)-N-(1H-indazol-5-yl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3S)-N-(1H-indazol-5-yl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 97079601 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (3S)-N-(1H-indazol-5-yl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13N3O3S/c16-12(8-3-4-19(17,18)7-8)14-10-1-2-11-9(5-10)6-13-15-11/h1-2,5-6,8H,3-4,7H2,(H,13,15)(H,14,16)/t8-/m1/s1 |
| InChIKey | GZRDZHUZVZNPTC-MRVPVSSYSA-N |
| XLogP | 0.94 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |