C18H23N5OS — CID 118779226
1-(4-ethylsulfanylphenyl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea (PubChem CID 118779226) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(4-ethylsulfanylphenyl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 118779226 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
| SMILES | CCSc1ccc(NC(=O)NC2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C18H23N5OS/c1-2-25-16-5-3-14(4-6-16)21-18(24)22-15-7-11-23(12-8-15)17-13-19-9-10-20-17/h3-6,9-10,13,15H,2,7-8,11-12H2,1H3,(H2,21,22,24) |
| InChIKey | WGDQTCRESMCENL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |