C19H24N4OS — CID 118778072
3-benzylsulfanyl-N-(1-pyrazin-2-ylpiperidin-4-yl)propanamide (PubChem CID 118778072) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-(1-pyrazin-2-ylpiperidin-4-yl)propanamide.
| Compound Name | 3-benzylsulfanyl-N-(1-pyrazin-2-ylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 118778072 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-benzylsulfanyl-N-(1-pyrazin-2-ylpiperidin-4-yl)propanamide |
| SMILES | O=C(CCSCc1ccccc1)NC1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C19H24N4OS/c24-19(8-13-25-15-16-4-2-1-3-5-16)22-17-6-11-23(12-7-17)18-14-20-9-10-21-18/h1-5,9-10,14,17H,6-8,11-13,15H2,(H,22,24) |
| InChIKey | KLCBKNPWUMPFPB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|