C17H29N5O — CID 136524276
1-(1-methylpyrazol-3-yl)-3-[(1-piperidin-1-ylcyclohexyl)methyl]urea (PubChem CID 136524276) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(1-methylpyrazol-3-yl)-3-[(1-piperidin-1-ylcyclohexyl)methyl]urea.
| Compound Name | 1-(1-methylpyrazol-3-yl)-3-[(1-piperidin-1-ylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 136524276 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-(1-methylpyrazol-3-yl)-3-[(1-piperidin-1-ylcyclohexyl)methyl]urea |
| SMILES | Cn1ccc(NC(=O)NCC2(N3CCCCC3)CCCCC2)n1 |
| InChI | InChI=1S/C17H29N5O/c1-21-13-8-15(20-21)19-16(23)18-14-17(9-4-2-5-10-17)22-11-6-3-7-12-22/h8,13H,2-7,9-12,14H2,1H3,(H2,18,19,20,23) |
| InChIKey | XDQQJHYKNMTKIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |