C14H17N5O2S — CID 125168490
1-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea (PubChem CID 125168490) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea.
| Compound Name | 1-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 125168490 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
| SMILES | C[C@H]1Cc2cc(NC(=O)NCCSc3cn[nH]n3)ccc2O1 |
| InChI | InChI=1S/C14H17N5O2S/c1-9-6-10-7-11(2-3-12(10)21-9)17-14(20)15-4-5-22-13-8-16-19-18-13/h2-3,7-9H,4-6H2,1H3,(H2,15,17,20)(H,16,18,19)/t9-/m0/s1 |
| InChIKey | AZKUYFMQORXVQT-VIFPVBQESA-N |
| XLogP | 2.04 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|