C13H15N5O2S — CID 72852947
1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea (PubChem CID 72852947) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 72852947 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
| SMILES | O=C(NCCSc1cn[nH]n1)Nc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H15N5O2S/c19-13(14-3-4-21-12-6-15-18-17-12)16-11-2-1-9-7-20-8-10(9)5-11/h1-2,5-6H,3-4,7-8H2,(H2,14,16,19)(H,15,17,18) |
| InChIKey | QUWZPGQVRTWCBD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|