C14H16N4O2S2 — CID 118785656
1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]urea (PubChem CID 118785656) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]urea.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 118785656 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]urea |
| SMILES | Cc1nnc(SCCNC(=O)Nc2ccc3c(c2)COC3)s1 |
| InChI | InChI=1S/C14H16N4O2S2/c1-9-17-18-14(22-9)21-5-4-15-13(19)16-12-3-2-10-7-20-8-11(10)6-12/h2-3,6H,4-5,7-8H2,1H3,(H2,15,16,19) |
| InChIKey | SWIWUFJYMJACGH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|