C13H16ClFN2O3 — CID 125169396
(3R)-N-(2-chloro-4-fluoro-5-methylphenyl)-3-(hydroxymethyl)morpholine-4-carboxamide (PubChem CID 125169396) has the molecular formula C13H16ClFN2O3 and a molecular weight of 302.73 g/mol. Its IUPAC name is (3R)-N-(2-chloro-4-fluoro-5-methylphenyl)-3-(hydroxymethyl)morpholine-4-carboxamide.
| Compound Name | (3R)-N-(2-chloro-4-fluoro-5-methylphenyl)-3-(hydroxymethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 125169396 |
| Molecular Formula | C13H16ClFN2O3 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (3R)-N-(2-chloro-4-fluoro-5-methylphenyl)-3-(hydroxymethyl)morpholine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCOC[C@H]2CO)c(Cl)cc1F |
| InChI | InChI=1S/C13H16ClFN2O3/c1-8-4-12(10(14)5-11(8)15)16-13(19)17-2-3-20-7-9(17)6-18/h4-5,9,18H,2-3,6-7H2,1H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | PQXLZRKEUUYTEW-SECBINFHSA-N |
| XLogP | 2.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |