C18H24N4O3S — CID 125169583
1-benzyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 125169583) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-benzyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-benzyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 125169583 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-benzyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | Cc1nn(C)c(C)c1NC(=O)N(Cc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24N4O3S/c1-13-17(14(2)21(3)20-13)19-18(23)22(11-15-7-5-4-6-8-15)16-9-10-26(24,25)12-16/h4-8,16H,9-12H2,1-3H3,(H,19,23)/t16-/m1/s1 |
| InChIKey | VZCIGPFIVBXFAP-MRXNPFEDSA-N |
| XLogP | 2.26 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |