C17H15ClN4O3 — CID 12517313
2-[4-(7-chloro-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl)phenoxy]acetohydrazide (PubChem CID 12517313) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is 2-[4-(7-chloro-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl)phenoxy]acetohydrazide.
| Compound Name | 2-[4-(7-chloro-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl)phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 12517313 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[4-(7-chloro-2-oxo-1,3-dihydro-1,4-benzodiazepin-5-yl)phenoxy]acetohydrazide |
| SMILES | NNC(=O)COc1ccc(C2=NCC(=O)Nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H15ClN4O3/c18-11-3-6-14-13(7-11)17(20-8-15(23)21-14)10-1-4-12(5-2-10)25-9-16(24)22-19/h1-7H,8-9,19H2,(H,21,23)(H,22,24) |
| InChIKey | HJOWQWTZUKWYOL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|