C16H13ClN2O — CID 154109464
5-benzyl-7-chloro-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 154109464) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is 5-benzyl-7-chloro-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-benzyl-7-chloro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 154109464 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-benzyl-7-chloro-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(Cc2ccccc2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C16H13ClN2O/c17-12-6-7-14-13(9-12)15(18-10-16(20)19-14)8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H,19,20) |
| InChIKey | CJMDZCRGXBWNAB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |