C15H18N2O3S — CID 125174611
1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 125174611) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 125174611 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | O=C(Nc1cccc2c1CCCC2)N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18N2O3S/c18-15(16-12-8-9-21(19,20)10-12)17-14-7-3-5-11-4-1-2-6-13(11)14/h3,5,7-9,12H,1-2,4,6,10H2,(H2,16,17,18)/t12-/m1/s1 |
| InChIKey | FWIYZAVEMIAPNR-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |