C25H29N3O4S — CID 125177255
(5S)-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-[(2-methylfuran-3-carbonyl)amino]-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide (PubChem CID 125177255) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is (5S)-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-[(2-methylfuran-3-carbonyl)amino]-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide.
| Compound Name | (5S)-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-[(2-methylfuran-3-carbonyl)amino]-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 125177255 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (5S)-N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-[(2-methylfuran-3-carbonyl)amino]-7-oxo-5,6-dihydro-4H-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1nc2c(s1)C(=O)C[C@@H](C(=O)NCCC1=CC[C@H]3C[C@@H]1C3(C)C)C2 |
| InChI | InChI=1S/C25H29N3O4S/c1-13-17(7-9-32-13)23(31)28-24-27-19-10-15(11-20(29)21(19)33-24)22(30)26-8-6-14-4-5-16-12-18(14)25(16,2)3/h4,7,9,15-16,18H,5-6,8,10-12H2,1-3H3,(H,26,30)(H,27,28,31)/t15-,16-,18-/m0/s1 |
| InChIKey | OJPHODLARXIJIK-BQFCYCMXSA-N |
| XLogP | 4.54 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|