C15H24N2O4 — CID 125179633
1-(5-tert-butyl-2-methoxyphenyl)-3-[(2S)-2,3-dihydroxypropyl]urea (PubChem CID 125179633) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methoxyphenyl)-3-[(2S)-2,3-dihydroxypropyl]urea.
| Compound Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[(2S)-2,3-dihydroxypropyl]urea |
|---|---|
| PubChem CID | 125179633 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(5-tert-butyl-2-methoxyphenyl)-3-[(2S)-2,3-dihydroxypropyl]urea |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)NC[C@H](O)CO |
| InChI | InChI=1S/C15H24N2O4/c1-15(2,3)10-5-6-13(21-4)12(7-10)17-14(20)16-8-11(19)9-18/h5-7,11,18-19H,8-9H2,1-4H3,(H2,16,17,20)/t11-/m0/s1 |
| InChIKey | YSGSYDDFRJOBFB-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |