C7H13BF3- — CID 125180328
[(Z)-4,4-dimethylpent-2-en-2-yl]-trifluoroboranuide (PubChem CID 125180328) has the molecular formula C7H13BF3- and a molecular weight of 164.99 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-en-2-yl]-trifluoroboranuide.
| Compound Name | [(Z)-4,4-dimethylpent-2-en-2-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 125180328 |
| Molecular Formula | C7H13BF3- |
| Molecular Weight | 164.99 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-en-2-yl]-trifluoroboranuide |
| SMILES | C/C(=C\C(C)(C)C)[B-](F)(F)F |
| InChI | InChI=1S/C7H13BF3/c1-6(8(9,10)11)5-7(2,3)4/h5H,1-4H3/q-1/b6-5+ |
| InChIKey | ILKSIZRRDUMGDJ-AATRIKPKSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|