C9H19AlO — CID 134905939
[(Z)-4,4-dimethylpent-2-en-2-yl]oxy-dimethylalumane (PubChem CID 134905939) has the molecular formula C9H19AlO and a molecular weight of 170.23 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-en-2-yl]oxy-dimethylalumane.
| Compound Name | [(Z)-4,4-dimethylpent-2-en-2-yl]oxy-dimethylalumane |
|---|---|
| PubChem CID | 134905939 |
| Molecular Formula | C9H19AlO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-en-2-yl]oxy-dimethylalumane |
| SMILES | C/C(=C/C(C)(C)C)O[Al](C)C |
| InChI | InChI=1S/C7H14O.2CH3.Al/c1-6(8)5-7(2,3)4;;;/h5,8H,1-4H3;2*1H3;/q;;;+1/p-1/b6-5-;;; |
| InChIKey | ZPHSQJSLWLKSQH-WTUPQPTJSA-M |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|