C7H13LiO2 — CID 23691907
lithium (E)-1-methoxy-3,3-dimethylbut-1-en-1-olate (PubChem CID 23691907) has the molecular formula C7H13LiO2 and a molecular weight of 136.12 g/mol. Its IUPAC name is lithium (E)-1-methoxy-3,3-dimethylbut-1-en-1-olate.
| Compound Name | lithium (E)-1-methoxy-3,3-dimethylbut-1-en-1-olate |
|---|---|
| PubChem CID | 23691907 |
| Molecular Formula | C7H13LiO2 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | lithium (E)-1-methoxy-3,3-dimethylbut-1-en-1-olate |
| SMILES | CO/C([O-])=C/C(C)(C)C.[Li+] |
| InChI | InChI=1S/C7H14O2.Li/c1-7(2,3)5-6(8)9-4;/h5,8H,1-4H3;/q;+1/p-1/b6-5+; |
| InChIKey | OMQPSRBXWCECMI-IPZCTEOASA-M |
| XLogP | -2.12 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|