C10H15NO — CID 158127375
(E)-2-(1-methoxyethenyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 158127375) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (E)-2-(1-methoxyethenyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(1-methoxyethenyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 158127375 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (E)-2-(1-methoxyethenyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | C=C(OC)/C(C#N)=C/C(C)(C)C |
| InChI | InChI=1S/C10H15NO/c1-8(12-5)9(7-11)6-10(2,3)4/h6H,1H2,2-5H3/b9-6+ |
| InChIKey | VJVVESHDOCGDMA-RMKNXTFCSA-N |
| XLogP | 2.64 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|