C20H21NO4 — CID 125180781
methyl (2E)-2-[(2R,4aS,10aR)-2-cyano-7-methoxy-2-methyl-9-oxo-4,4a,10,10a-tetrahydro-3H-phenanthren-1-ylidene]acetate (PubChem CID 125180781) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl (2E)-2-[(2R,4aS,10aR)-2-cyano-7-methoxy-2-methyl-9-oxo-4,4a,10,10a-tetrahydro-3H-phenanthren-1-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2R,4aS,10aR)-2-cyano-7-methoxy-2-methyl-9-oxo-4,4a,10,10a-tetrahydro-3H-phenanthren-1-ylidene]acetate |
|---|---|
| PubChem CID | 125180781 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl (2E)-2-[(2R,4aS,10aR)-2-cyano-7-methoxy-2-methyl-9-oxo-4,4a,10,10a-tetrahydro-3H-phenanthren-1-ylidene]acetate |
| SMILES | COC(=O)/C=C1\[C@@H]2CC(=O)c3cc(OC)ccc3[C@H]2CC[C@@]1(C)C#N |
| InChI | InChI=1S/C20H21NO4/c1-20(11-21)7-6-14-13-5-4-12(24-2)8-16(13)18(22)9-15(14)17(20)10-19(23)25-3/h4-5,8,10,14-15H,6-7,9H2,1-3H3/b17-10+/t14-,15-,20+/m1/s1 |
| InChIKey | WUKJWSATQLGIGS-XUZRFLIGSA-N |
| XLogP | 3.40 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|