C18H26I2O2 — CID 70228376
2-iodo-1-(2-iodo-4-methoxy-3,3,5,5-tetramethylcyclohexyl)-4-methoxybenzene (PubChem CID 70228376) has the molecular formula C18H26I2O2 and a molecular weight of 528.21 g/mol. Its IUPAC name is 2-iodo-1-(2-iodo-4-methoxy-3,3,5,5-tetramethylcyclohexyl)-4-methoxybenzene.
| Compound Name | 2-iodo-1-(2-iodo-4-methoxy-3,3,5,5-tetramethylcyclohexyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 70228376 |
| Molecular Formula | C18H26I2O2 |
| Molecular Weight | 528.21 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 2-iodo-1-(2-iodo-4-methoxy-3,3,5,5-tetramethylcyclohexyl)-4-methoxybenzene |
| SMILES | COc1ccc(C2CC(C)(C)C(OC)C(C)(C)C2I)c(I)c1 |
| InChI | InChI=1S/C18H26I2O2/c1-17(2)10-13(15(20)18(3,4)16(17)22-6)12-8-7-11(21-5)9-14(12)19/h7-9,13,15-16H,10H2,1-6H3 |
| InChIKey | FZXCYDIJUJHGAK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.21 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|