C13H14INO2 — CID 172646902
N-(1-bicyclo[1.1.1]pentanyl)-2-iodo-4-methoxybenzamide (PubChem CID 172646902) has the molecular formula C13H14INO2 and a molecular weight of 343.16 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-2-iodo-4-methoxybenzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-2-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 172646902 |
| Molecular Formula | C13H14INO2 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-2-iodo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC23CC(C2)C3)c(I)c1 |
| InChI | InChI=1S/C13H14INO2/c1-17-9-2-3-10(11(14)4-9)12(16)15-13-5-8(6-13)7-13/h2-4,8H,5-7H2,1H3,(H,15,16) |
| InChIKey | GUMTXGADBRXXCE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|