C14H13F3INO2 — CID 172646946
N-(1-bicyclo[1.1.1]pentanyl)-4-iodo-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 172646946) has the molecular formula C14H13F3INO2 and a molecular weight of 411.16 g/mol. Its IUPAC name is N-(1-bicyclo[1.1.1]pentanyl)-4-iodo-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(1-bicyclo[1.1.1]pentanyl)-4-iodo-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 172646946 |
| Molecular Formula | C14H13F3INO2 |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | N-(1-bicyclo[1.1.1]pentanyl)-4-iodo-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NC12CC(C1)C2)c1ccc(I)cc1OCC(F)(F)F |
| InChI | InChI=1S/C14H13F3INO2/c15-14(16,17)7-21-11-3-9(18)1-2-10(11)12(20)19-13-4-8(5-13)6-13/h1-3,8H,4-7H2,(H,19,20) |
| InChIKey | LLVONZYUBZPCPH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|