C12H9F6IO4 — CID 168826337
2-(2,2,3,3,4,4-hexafluoro-5-hydroxypentoxy)-4-iodobenzoic acid (PubChem CID 168826337) has the molecular formula C12H9F6IO4 and a molecular weight of 458.09 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4-hexafluoro-5-hydroxypentoxy)-4-iodobenzoic acid.
| Compound Name | 2-(2,2,3,3,4,4-hexafluoro-5-hydroxypentoxy)-4-iodobenzoic acid |
|---|---|
| PubChem CID | 168826337 |
| Molecular Formula | C12H9F6IO4 |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | 2-(2,2,3,3,4,4-hexafluoro-5-hydroxypentoxy)-4-iodobenzoic acid |
| SMILES | O=C(O)c1ccc(I)cc1OCC(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C12H9F6IO4/c13-10(14,4-20)12(17,18)11(15,16)5-23-8-3-6(19)1-2-7(8)9(21)22/h1-3,20H,4-5H2,(H,21,22) |
| InChIKey | CTWKDXFADNUYNE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|