C20H24N2O2 — CID 125180793
(4S,12R,13S,14R,19R,21R)-14-methoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraene (PubChem CID 125180793) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4S,12R,13S,14R,19R,21R)-14-methoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraene.
| Compound Name | (4S,12R,13S,14R,19R,21R)-14-methoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraene |
|---|---|
| PubChem CID | 125180793 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (4S,12R,13S,14R,19R,21R)-14-methoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraene |
| SMILES | CO[C@@H]1OCC=C2CN3CC[C@]45c6ccccc6N[C@@H]4[C@@H]1[C@H]2C[C@@H]35 |
| InChI | InChI=1S/C20H24N2O2/c1-23-19-17-13-10-16-20(7-8-22(16)11-12(13)6-9-24-19)14-4-2-3-5-15(14)21-18(17)20/h2-6,13,16-19,21H,7-11H2,1H3/t13-,16+,17-,18+,19+,20+/m0/s1 |
| InChIKey | XRQDWVFNYVRONQ-NHTFYEETSA-N |
| XLogP | 2.37 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|