C16H17FN4O2 — CID 125185502
(4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 125185502) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 125185502 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Fc1cccnc1O[C@@H]1CC[C@@H]2[C@@H]1OCCN2c1ncccn1 |
| InChI | InChI=1S/C16H17FN4O2/c17-11-3-1-6-18-15(11)23-13-5-4-12-14(13)22-10-9-21(12)16-19-7-2-8-20-16/h1-3,6-8,12-14H,4-5,9-10H2/t12-,13-,14+/m1/s1 |
| InChIKey | VXVLJEIZMIAZLM-MCIONIFRSA-N |
| XLogP | 1.83 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |