C18H25FN2O3 — CID 125183914
(4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 125183914) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 125183914 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (4aR,7R,7aS)-7-[(3-fluoro-2-pyridinyl)oxy]-4-(oxan-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Fc1cccnc1O[C@@H]1CC[C@@H]2[C@@H]1OCCN2CC1CCOCC1 |
| InChI | InChI=1S/C18H25FN2O3/c19-14-2-1-7-20-18(14)24-16-4-3-15-17(16)23-11-8-21(15)12-13-5-9-22-10-6-13/h1-2,7,13,15-17H,3-6,8-12H2/t15-,16-,17+/m1/s1 |
| InChIKey | AENCJUPRFYCMQU-ZACQAIPSSA-N |
| XLogP | 2.26 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |