C22H22F3N3O3S2 — CID 1252184
2-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]ethanol (PubChem CID 1252184) has the molecular formula C22H22F3N3O3S2 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 1252184 |
| Molecular Formula | C22H22F3N3O3S2 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-[4-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazol-3-yl]ethanol |
| SMILES | O=S(=O)(c1ccc(-c2cs/c(=N\c3cccc(C(F)(F)F)c3)n2CCO)cc1)N1CCCC1 |
| InChI | InChI=1S/C22H22F3N3O3S2/c23-22(24,25)17-4-3-5-18(14-17)26-21-28(12-13-29)20(15-32-21)16-6-8-19(9-7-16)33(30,31)27-10-1-2-11-27/h3-9,14-15,29H,1-2,10-13H2/b26-21- |
| InChIKey | JHRQXMXXVYCCTE-QLYXXIJNSA-N |
| XLogP | 4.24 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|