C17H19N3O3S — CID 125220951
(E)-1-[(3aS,7S,7aS)-7-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 125220951) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is (E)-1-[(3aS,7S,7aS)-7-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(3aS,7S,7aS)-7-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 125220951 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (E)-1-[(3aS,7S,7aS)-7-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-2-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | Cc1noc([C@@H]2COC[C@@H]3CN(C(=O)/C=C/c4cccs4)C[C@@H]32)n1 |
| InChI | InChI=1S/C17H19N3O3S/c1-11-18-17(23-19-11)15-10-22-9-12-7-20(8-14(12)15)16(21)5-4-13-3-2-6-24-13/h2-6,12,14-15H,7-10H2,1H3/b5-4+/t12-,14-,15+/m0/s1 |
| InChIKey | UVTARAGZDLVYJP-LMWGVWCVSA-N |
| XLogP | 2.34 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|