C14H17N3O2S — CID 124809106
(3S,3aR,6aR)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124809106) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3S,3aR,6aR)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124809106 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (3S,3aR,6aR)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-5-(thiophen-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1noc([C@@H]2CO[C@H]3CN(Cc4cccs4)C[C@H]32)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-9-15-14(19-16-9)12-8-18-13-7-17(6-11(12)13)5-10-3-2-4-20-10/h2-4,11-13H,5-8H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | NOTDNTRBGMEXID-XQQFMLRXSA-N |
| XLogP | 2.05 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |