C16H24N4O — CID 125222291
1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-methylbutan-1-one (PubChem CID 125222291) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 125222291 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1C[C@@H]2CN(c3cnccn3)CC[C@H]2C1 |
| InChI | InChI=1S/C16H24N4O/c1-12(2)7-16(21)20-9-13-3-6-19(10-14(13)11-20)15-8-17-4-5-18-15/h4-5,8,12-14H,3,6-7,9-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | CTAXPQUXFPSSHR-KBPBESRZSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |