C15H22N4O — CID 125223130
1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]butan-1-one (PubChem CID 125223130) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]butan-1-one.
| Compound Name | 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 125223130 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-[(3aS,7aR)-5-pyrazin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1C[C@@H]2CN(c3cnccn3)CC[C@H]2C1 |
| InChI | InChI=1S/C15H22N4O/c1-2-3-15(20)19-9-12-4-7-18(10-13(12)11-19)14-8-16-5-6-17-14/h5-6,8,12-13H,2-4,7,9-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | LGKSREYGLCKJOK-STQMWFEESA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |