C23H24N4O2 — CID 125232723
(3aS,4S,6aR)-N-(2-methylphenyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide (PubChem CID 125232723) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (3aS,4S,6aR)-N-(2-methylphenyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide.
| Compound Name | (3aS,4S,6aR)-N-(2-methylphenyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
|---|---|
| PubChem CID | 125232723 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (3aS,4S,6aR)-N-(2-methylphenyl)-5'-oxo-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1C[C@@H]2CC[C@]3(N=C(c4ccccc4)NC3=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H24N4O2/c1-15-7-5-6-10-19(15)24-22(29)27-13-17-11-12-23(18(17)14-27)21(28)25-20(26-23)16-8-3-2-4-9-16/h2-10,17-18H,11-14H2,1H3,(H,24,29)(H,25,26,28)/t17-,18+,23-/m0/s1 |
| InChIKey | MEAONQJLPHMTGJ-IXFSTUDKSA-N |
| XLogP | 3.18 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |