C22H26FN3O4S — CID 125246013
(1R,11R)-N-[2-(4-fluorophenyl)ethyl]-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide (PubChem CID 125246013) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is (1R,11R)-N-[2-(4-fluorophenyl)ethyl]-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide.
| Compound Name | (1R,11R)-N-[2-(4-fluorophenyl)ethyl]-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
|---|---|
| PubChem CID | 125246013 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (1R,11R)-N-[2-(4-fluorophenyl)ethyl]-10-methyl-9,9-dioxo-2-oxa-9λ6-thia-10,14-diazatricyclo[9.5.0.03,8]hexadeca-3,5,7-triene-14-carboxamide |
| SMILES | CN1[C@@H]2CCN(C(=O)NCCc3ccc(F)cc3)CC[C@H]2Oc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C22H26FN3O4S/c1-25-18-11-14-26(22(27)24-13-10-16-6-8-17(23)9-7-16)15-12-19(18)30-20-4-2-3-5-21(20)31(25,28)29/h2-9,18-19H,10-15H2,1H3,(H,24,27)/t18-,19-/m1/s1 |
| InChIKey | UNJZUWGAUUWRPS-RTBURBONSA-N |
| XLogP | 2.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |