C18H24N4O4S — CID 125256334
(4aS,7aS)-6-(4-methoxyphenyl)sulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 125256334) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (4aS,7aS)-6-(4-methoxyphenyl)sulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aS,7aS)-6-(4-methoxyphenyl)sulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 125256334 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (4aS,7aS)-6-(4-methoxyphenyl)sulfonyl-4-[(1-methylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H]3OCCN(Cc4cnn(C)c4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H24N4O4S/c1-20-10-14(9-19-20)11-21-7-8-26-18-13-22(12-17(18)21)27(23,24)16-5-3-15(25-2)4-6-16/h3-6,9-10,17-18H,7-8,11-13H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | UUZCVNGOPWQCBN-ROUUACIJSA-N |
| XLogP | 0.70 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |