C15H23N3O6S2 — CID 124801212
(4aS,7aR)-6-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide (PubChem CID 124801212) has the molecular formula C15H23N3O6S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (4aS,7aR)-6-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide.
| Compound Name | (4aS,7aR)-6-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide |
|---|---|
| PubChem CID | 124801212 |
| Molecular Formula | C15H23N3O6S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (4aS,7aR)-6-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H]3OCCN(S(=O)(=O)N(C)C)[C@H]3C2)cc1 |
| InChI | InChI=1S/C15H23N3O6S2/c1-16(2)26(21,22)18-8-9-24-15-11-17(10-14(15)18)25(19,20)13-6-4-12(23-3)5-7-13/h4-7,14-15H,8-11H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | KFZIATNXTNMVFF-LSDHHAIUSA-N |
| XLogP | -0.42 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |