C15H20N4O5S2 — CID 124805156
(4aS,7aR)-6-(4-cyanophenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide (PubChem CID 124805156) has the molecular formula C15H20N4O5S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (4aS,7aR)-6-(4-cyanophenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide.
| Compound Name | (4aS,7aR)-6-(4-cyanophenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide |
|---|---|
| PubChem CID | 124805156 |
| Molecular Formula | C15H20N4O5S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (4aS,7aR)-6-(4-cyanophenyl)sulfonyl-N,N-dimethyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCO[C@@H]2CN(S(=O)(=O)c3ccc(C#N)cc3)C[C@@H]21 |
| InChI | InChI=1S/C15H20N4O5S2/c1-17(2)26(22,23)19-7-8-24-15-11-18(10-14(15)19)25(20,21)13-5-3-12(9-16)4-6-13/h3-6,14-15H,7-8,10-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | YPRBWXRRBSDGOG-LSDHHAIUSA-N |
| XLogP | -0.56 |
| TPSA | 111.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |