C13H13NO4 — CID 125265673
ethyl 3-[(R)-hydroxy(phenyl)methyl]-1,2-oxazole-4-carboxylate (PubChem CID 125265673) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 3-[(R)-hydroxy(phenyl)methyl]-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 3-[(R)-hydroxy(phenyl)methyl]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 125265673 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl 3-[(R)-hydroxy(phenyl)methyl]-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1conc1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO4/c1-2-17-13(16)10-8-18-14-11(10)12(15)9-6-4-3-5-7-9/h3-8,12,15H,2H2,1H3/t12-/m1/s1 |
| InChIKey | YQVHONBSVNCWQC-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |