About ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate
ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate (PubChem CID 154642707) has the molecular formula C8H9F2NO3
and a molecular weight of 205.16 g/mol. Its IUPAC name is ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate.
Analyze ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate?
The IUPAC name of ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate (CID 154642707) is ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate?
The canonical SMILES for ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate is CCOC(=O)c1conc1CC(F)F.
What is the InChIKey of ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate?
The InChIKey is DQJKTXLNLFUDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO3/c1-2-13-8(12)5-4-14-11-6(5)3-7(9)10/h4,7H,2-3H2,1H3.
What are the key properties of ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate?
ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate has a molecular weight of 205.16 g/mol, XLogP of 1.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 154642707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).