C20H17ClN5O2P — CID 12533203
5-(3-chlorophenyl)-N-dianilinophosphoryl-1,3,4-oxadiazol-2-amine (PubChem CID 12533203) has the molecular formula C20H17ClN5O2P and a molecular weight of 425.82 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-dianilinophosphoryl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(3-chlorophenyl)-N-dianilinophosphoryl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 12533203 |
| Molecular Formula | C20H17ClN5O2P |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 5-(3-chlorophenyl)-N-dianilinophosphoryl-1,3,4-oxadiazol-2-amine |
| SMILES | O=P(Nc1ccccc1)(Nc1ccccc1)Nc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C20H17ClN5O2P/c21-16-9-7-8-15(14-16)19-22-23-20(28-19)26-29(27,24-17-10-3-1-4-11-17)25-18-12-5-2-6-13-18/h1-14H,(H3,23,24,25,26,27) |
| InChIKey | WVJMPDGATSKIJX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|