C16H10F3N3 — CID 12535292
2,4-diphenyl-6-(trifluoromethyl)-1,3,5-triazine (PubChem CID 12535292) has the molecular formula C16H10F3N3 and a molecular weight of 301.27 g/mol. Its IUPAC name is 2,4-diphenyl-6-(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 12535292 |
| Molecular Formula | C16H10F3N3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2,4-diphenyl-6-(trifluoromethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H10F3N3/c17-16(18,19)15-21-13(11-7-3-1-4-8-11)20-14(22-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YCCZNLIVPBQIRQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |