C10H7N3O — CID 12540550
chromeno[4,3-c]pyrazol-3-amine (PubChem CID 12540550) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is chromeno[4,3-c]pyrazol-3-amine.
| Compound Name | chromeno[4,3-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 12540550 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | chromeno[4,3-c]pyrazol-3-amine |
| SMILES | Nc1nnc2c3ccccc3occ1-2 |
| InChI | InChI=1S/C10H7N3O/c11-10-7-5-14-8-4-2-1-3-6(8)9(7)12-13-10/h1-5H,(H2,11,13) |
| InChIKey | XLSPALFLQQPFOC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |