About 3-furo[3,2-c]pyridin-4-ylchromen-4-one
3-furo[3,2-c]pyridin-4-ylchromen-4-one (PubChem CID 39826562) has the molecular formula C16H9NO3
and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-furo[3,2-c]pyridin-4-ylchromen-4-one.
Molecular Properties
| Compound Name | 3-furo[3,2-c]pyridin-4-ylchromen-4-one |
| PubChem CID | 39826562 |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-furo[3,2-c]pyridin-4-ylchromen-4-one |
| SMILES | O=c1c(-c2nccc3occc23)coc2ccccc12 |
| InChI | InChI=1S/C16H9NO3/c18-16-11-3-1-2-4-13(11)20-9-12(16)15-10-6-8-19-14(10)5-7-17-15/h1-9H |
| InChIKey | KYNKUOYHBKYMMZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-furo[3,2-c]pyridin-4-ylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-furo[3,2-c]pyridin-4-ylchromen-4-one?
The IUPAC name of 3-furo[3,2-c]pyridin-4-ylchromen-4-one (CID 39826562) is 3-furo[3,2-c]pyridin-4-ylchromen-4-one.
What is the SMILES notation for 3-furo[3,2-c]pyridin-4-ylchromen-4-one?
The canonical SMILES for 3-furo[3,2-c]pyridin-4-ylchromen-4-one is O=c1c(-c2nccc3occc23)coc2ccccc12.
What is the InChIKey of 3-furo[3,2-c]pyridin-4-ylchromen-4-one?
The InChIKey is KYNKUOYHBKYMMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO3/c18-16-11-3-1-2-4-13(11)20-9-12(16)15-10-6-8-19-14(10)5-7-17-15/h1-9H.
What are the key properties of 3-furo[3,2-c]pyridin-4-ylchromen-4-one?
3-furo[3,2-c]pyridin-4-ylchromen-4-one has a molecular weight of 263.25 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-furo[3,2-c]pyridin-4-ylchromen-4-one is sourced from PubChem (CID 39826562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).