C16H9N3O3 — CID 15471237
3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)chromen-4-one (PubChem CID 15471237) has the molecular formula C16H9N3O3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)chromen-4-one.
| Compound Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)chromen-4-one |
|---|---|
| PubChem CID | 15471237 |
| Molecular Formula | C16H9N3O3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)chromen-4-one |
| SMILES | O=c1c(-c2nnc(-c3cccnc3)o2)coc2ccccc12 |
| InChI | InChI=1S/C16H9N3O3/c20-14-11-5-1-2-6-13(11)21-9-12(14)16-19-18-15(22-16)10-4-3-7-17-8-10/h1-9H |
| InChIKey | HQXABBZYRUMSDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |