C19H20FNO3 — CID 125415643
(3R,4S)-4-[(2-fluorophenyl)methyl-formylamino]-3-methyl-4-phenylbutanoic acid (PubChem CID 125415643) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is (3R,4S)-4-[(2-fluorophenyl)methyl-formylamino]-3-methyl-4-phenylbutanoic acid.
| Compound Name | (3R,4S)-4-[(2-fluorophenyl)methyl-formylamino]-3-methyl-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 125415643 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3R,4S)-4-[(2-fluorophenyl)methyl-formylamino]-3-methyl-4-phenylbutanoic acid |
| SMILES | C[C@H](CC(=O)O)[C@@H](c1ccccc1)N(C=O)Cc1ccccc1F |
| InChI | InChI=1S/C19H20FNO3/c1-14(11-18(23)24)19(15-7-3-2-4-8-15)21(13-22)12-16-9-5-6-10-17(16)20/h2-10,13-14,19H,11-12H2,1H3,(H,23,24)/t14-,19+/m1/s1 |
| InChIKey | USFXHMYLDPTJLO-KUHUBIRLSA-N |
| XLogP | 3.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|