C30H26O8 — CID 12541627
2-hydroxy-3,9-dimethoxy-6,11-bis(4-methoxyphenyl)-6,11-dihydrobenzo[c][1]benzoxepine-7,10-dione (PubChem CID 12541627) has the molecular formula C30H26O8 and a molecular weight of 514.53 g/mol. Its IUPAC name is 2-hydroxy-3,9-dimethoxy-6,11-bis(4-methoxyphenyl)-6,11-dihydrobenzo[c][1]benzoxepine-7,10-dione.
| Compound Name | 2-hydroxy-3,9-dimethoxy-6,11-bis(4-methoxyphenyl)-6,11-dihydrobenzo[c][1]benzoxepine-7,10-dione |
|---|---|
| PubChem CID | 12541627 |
| Molecular Formula | C30H26O8 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-hydroxy-3,9-dimethoxy-6,11-bis(4-methoxyphenyl)-6,11-dihydrobenzo[c][1]benzoxepine-7,10-dione |
| SMILES | COC1=CC(=O)C2=C(C1=O)C(c1ccc(OC)cc1)c1cc(O)c(OC)cc1OC2c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H26O8/c1-34-18-9-5-16(6-10-18)26-20-13-21(31)24(36-3)15-23(20)38-30(17-7-11-19(35-2)12-8-17)27-22(32)14-25(37-4)29(33)28(26)27/h5-15,26,30-31H,1-4H3 |
| InChIKey | SLDXVXWMULCLJG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|