C22H19BrN2O5S — CID 1254177
2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)acetamide (PubChem CID 1254177) has the molecular formula C22H19BrN2O5S and a molecular weight of 503.37 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 1254177 |
| Molecular Formula | C22H19BrN2O5S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)acetamide |
| SMILES | COc1cc2c(cc1NC(=O)CN(C)S(=O)(=O)c1ccc(Br)cc1)oc1ccccc12 |
| InChI | InChI=1S/C22H19BrN2O5S/c1-25(31(27,28)15-9-7-14(23)8-10-15)13-22(26)24-18-12-20-17(11-21(18)29-2)16-5-3-4-6-19(16)30-20/h3-12H,13H2,1-2H3,(H,24,26) |
| InChIKey | OLNFPPAKFLOOQI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |